C19H21F2NO2 — CID 167881605
3-[(2,3-difluorophenyl)methyl-(2-phenylpropyl)amino]propanoic acid (PubChem CID 167881605) has the molecular formula C19H21F2NO2 and a molecular weight of 333.38 g/mol. Its IUPAC name is 3-[(2,3-difluorophenyl)methyl-(2-phenylpropyl)amino]propanoic acid.
| Compound Name | 3-[(2,3-difluorophenyl)methyl-(2-phenylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 167881605 |
| Molecular Formula | C19H21F2NO2 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 3-[(2,3-difluorophenyl)methyl-(2-phenylpropyl)amino]propanoic acid |
| SMILES | CC(CN(CCC(=O)O)Cc1cccc(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C19H21F2NO2/c1-14(15-6-3-2-4-7-15)12-22(11-10-18(23)24)13-16-8-5-9-17(20)19(16)21/h2-9,14H,10-13H2,1H3,(H,23,24) |
| InChIKey | LNLMKDWZJHVQDP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |