C27H31NO4 — CID 66885405
2-[[3-(3-hydroxypropoxy)phenyl]methyl-(1-phenylethyl)amino]-1-(4-methoxyphenyl)ethanone (PubChem CID 66885405) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-[[3-(3-hydroxypropoxy)phenyl]methyl-(1-phenylethyl)amino]-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[[3-(3-hydroxypropoxy)phenyl]methyl-(1-phenylethyl)amino]-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 66885405 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 2-[[3-(3-hydroxypropoxy)phenyl]methyl-(1-phenylethyl)amino]-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CN(Cc2cccc(OCCCO)c2)C(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H31NO4/c1-21(23-9-4-3-5-10-23)28(20-27(30)24-12-14-25(31-2)15-13-24)19-22-8-6-11-26(18-22)32-17-7-16-29/h3-6,8-15,18,21,29H,7,16-17,19-20H2,1-2H3 |
| InChIKey | CVMAMYHWOGCEST-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|