C20H25NO3 — CID 171385082
methyl 5-(butylaminomethyl)-2-phenylmethoxybenzoate (PubChem CID 171385082) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is methyl 5-(butylaminomethyl)-2-phenylmethoxybenzoate.
| Compound Name | methyl 5-(butylaminomethyl)-2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 171385082 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | methyl 5-(butylaminomethyl)-2-phenylmethoxybenzoate |
| SMILES | CCCCNCc1ccc(OCc2ccccc2)c(C(=O)OC)c1 |
| InChI | InChI=1S/C20H25NO3/c1-3-4-12-21-14-17-10-11-19(18(13-17)20(22)23-2)24-15-16-8-6-5-7-9-16/h5-11,13,21H,3-4,12,14-15H2,1-2H3 |
| InChIKey | SAMZEKAUFFNGME-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|