About methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate
methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate (PubChem CID 131711552) has the molecular formula C17H16O6
and a molecular weight of 316.31 g/mol. Its IUPAC name is methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate.
Molecular Properties
| Compound Name | methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate |
| PubChem CID | 131711552 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate |
| SMILES | COC(=O)c1cc(C(=O)C=O)ccc1OCc1ccccc1.O |
| InChI | InChI=1S/C17H14O5.H2O/c1-21-17(20)14-9-13(15(19)10-18)7-8-16(14)22-11-12-5-3-2-4-6-12;/h2-10H,11H2,1H3;1H2 |
| InChIKey | UHXYLUGIQQBNPE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 101.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate?
The IUPAC name of methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate (CID 131711552) is methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate.
What is the SMILES notation for methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate?
The canonical SMILES for methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate is COC(=O)c1cc(C(=O)C=O)ccc1OCc1ccccc1.O.
What is the InChIKey of methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate?
The InChIKey is UHXYLUGIQQBNPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O5.H2O/c1-21-17(20)14-9-13(15(19)10-18)7-8-16(14)22-11-12-5-3-2-4-6-12;/h2-10H,11H2,1H3;1H2.
What are the key properties of methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate?
methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate has a molecular weight of 316.31 g/mol, XLogP of 1.61, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxaldehydoyl-2-phenylmethoxybenzoate;hydrate is sourced from PubChem (CID 131711552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).