C68H76N4O10S2 — CID 87181808
benzyl N-[4-[4-[4-[bis[(2S)-2-hydroxy-2-[3-(2-phenylethylsulfonylamino)-4-phenylmethoxyphenyl]ethyl]amino]butyl]phenyl]butyl]carbamate (PubChem CID 87181808) has the molecular formula C68H76N4O10S2 and a molecular weight of 1173.51 g/mol. Its IUPAC name is benzyl N-[4-[4-[4-[bis[(2S)-2-hydroxy-2-[3-(2-phenylethylsulfonylamino)-4-phenylmethoxyphenyl]ethyl]amino]butyl]phenyl]butyl]carbamate.
| Compound Name | benzyl N-[4-[4-[4-[bis[(2S)-2-hydroxy-2-[3-(2-phenylethylsulfonylamino)-4-phenylmethoxyphenyl]ethyl]amino]butyl]phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 87181808 |
| Molecular Formula | C68H76N4O10S2 |
| Molecular Weight | 1173.51 g/mol |
| Exact Mass | 1172.50 |
| IUPAC Name | benzyl N-[4-[4-[4-[bis[(2S)-2-hydroxy-2-[3-(2-phenylethylsulfonylamino)-4-phenylmethoxyphenyl]ethyl]amino]butyl]phenyl]butyl]carbamate |
| SMILES | O=C(NCCCCc1ccc(CCCCN(C[C@@H](O)c2ccc(OCc3ccccc3)c(NS(=O)(=O)CCc3ccccc3)c2)C[C@@H](O)c2ccc(OCc3ccccc3)c(NS(=O)(=O)CCc3ccccc3)c2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C68H76N4O10S2/c73-64(60-36-38-66(80-50-57-26-10-3-11-27-57)62(46-60)70-83(76,77)44-40-53-20-6-1-7-21-53)48-72(43-19-17-25-56-34-32-55(33-35-56)24-16-18-42-69-68(75)82-52-59-30-14-5-15-31-59)49-65(74)61-37-39-67(81-51-58-28-12-4-13-29-58)63(47-61)71-84(78,79)45-41-54-22-8-2-9-23-54/h1-15,20-23,26-39,46-47,64-65,70-71,73-74H,16-19,24-25,40-45,48-52H2,(H,69,75)/t64-,65-/m1/s1 |
| InChIKey | ODQHUCXRFYLLSN-WXQUPVAFSA-N |
| XLogP | 12.15 |
| TPSA | 192.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1173.51 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|