C43H53N3O6S — CID 87899517
N-[5-[(1S)-2-[benzyl-[6-[4-[3-(tert-butylsulfamoyl)phenyl]but-3-ynoxy]hexyl]amino]-1-hydroxyethyl]-2-phenylmethoxyphenyl]formamide (PubChem CID 87899517) has the molecular formula C43H53N3O6S and a molecular weight of 739.98 g/mol. Its IUPAC name is N-[5-[(1S)-2-[benzyl-[6-[4-[3-(tert-butylsulfamoyl)phenyl]but-3-ynoxy]hexyl]amino]-1-hydroxyethyl]-2-phenylmethoxyphenyl]formamide.
| Compound Name | N-[5-[(1S)-2-[benzyl-[6-[4-[3-(tert-butylsulfamoyl)phenyl]but-3-ynoxy]hexyl]amino]-1-hydroxyethyl]-2-phenylmethoxyphenyl]formamide |
|---|---|
| PubChem CID | 87899517 |
| Molecular Formula | C43H53N3O6S |
| Molecular Weight | 739.98 g/mol |
| Exact Mass | 739.37 |
| IUPAC Name | N-[5-[(1S)-2-[benzyl-[6-[4-[3-(tert-butylsulfamoyl)phenyl]but-3-ynoxy]hexyl]amino]-1-hydroxyethyl]-2-phenylmethoxyphenyl]formamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(C#CCCOCCCCCCN(Cc2ccccc2)C[C@@H](O)c2ccc(OCc3ccccc3)c(NC=O)c2)c1 |
| InChI | InChI=1S/C43H53N3O6S/c1-43(2,3)45-53(49,50)39-23-16-22-35(29-39)17-12-15-28-51-27-14-5-4-13-26-46(31-36-18-8-6-9-19-36)32-41(48)38-24-25-42(40(30-38)44-34-47)52-33-37-20-10-7-11-21-37/h6-11,16,18-25,29-30,34,41,45,48H,4-5,13-15,26-28,31-33H2,1-3H3,(H,44,47)/t41-/m1/s1 |
| InChIKey | WGRBBLBWWMXUSW-VQJSHJPSSA-N |
| XLogP | 7.47 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.98 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|