C33H44N4O5 — CID 87407706
3-[3-[6-[[(2R)-2-(3-formamido-4-phenylmethoxyphenyl)-2-hydroxyethyl]amino]hexoxy]propyl-methylamino]benzamide (PubChem CID 87407706) has the molecular formula C33H44N4O5 and a molecular weight of 576.74 g/mol. Its IUPAC name is 3-[3-[6-[[(2R)-2-(3-formamido-4-phenylmethoxyphenyl)-2-hydroxyethyl]amino]hexoxy]propyl-methylamino]benzamide.
| Compound Name | 3-[3-[6-[[(2R)-2-(3-formamido-4-phenylmethoxyphenyl)-2-hydroxyethyl]amino]hexoxy]propyl-methylamino]benzamide |
|---|---|
| PubChem CID | 87407706 |
| Molecular Formula | C33H44N4O5 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | 3-[3-[6-[[(2R)-2-(3-formamido-4-phenylmethoxyphenyl)-2-hydroxyethyl]amino]hexoxy]propyl-methylamino]benzamide |
| SMILES | CN(CCCOCCCCCCNC[C@H](O)c1ccc(OCc2ccccc2)c(NC=O)c1)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C33H44N4O5/c1-37(29-14-9-13-28(21-29)33(34)40)18-10-20-41-19-8-3-2-7-17-35-23-31(39)27-15-16-32(30(22-27)36-25-38)42-24-26-11-5-4-6-12-26/h4-6,9,11-16,21-22,25,31,35,39H,2-3,7-8,10,17-20,23-24H2,1H3,(H2,34,40)(H,36,38)/t31-/m0/s1 |
| InChIKey | YYQRHYNRIBOMBK-HKBQPEDESA-N |
| XLogP | 4.66 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|