C43H54N4O4 — CID 87181362
2-[(3S)-1-[9-[[(2S)-2-(3-formamido-4-phenylmethoxyphenyl)-2-hydroxyethyl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 87181362) has the molecular formula C43H54N4O4 and a molecular weight of 690.93 g/mol. Its IUPAC name is 2-[(3S)-1-[9-[[(2S)-2-(3-formamido-4-phenylmethoxyphenyl)-2-hydroxyethyl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[(3S)-1-[9-[[(2S)-2-(3-formamido-4-phenylmethoxyphenyl)-2-hydroxyethyl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 87181362 |
| Molecular Formula | C43H54N4O4 |
| Molecular Weight | 690.93 g/mol |
| Exact Mass | 690.41 |
| IUPAC Name | 2-[(3S)-1-[9-[[(2S)-2-(3-formamido-4-phenylmethoxyphenyl)-2-hydroxyethyl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | NC(=O)C(c1ccccc1)(c1ccccc1)[C@@H]1CCN(CCCCCCCCCNC[C@@H](O)c2ccc(OCc3ccccc3)c(NC=O)c2)C1 |
| InChI | InChI=1S/C43H54N4O4/c44-42(50)43(36-19-11-7-12-20-36,37-21-13-8-14-22-37)38-25-28-47(31-38)27-16-5-3-1-2-4-15-26-45-30-40(49)35-23-24-41(39(29-35)46-33-48)51-32-34-17-9-6-10-18-34/h6-14,17-24,29,33,38,40,45,49H,1-5,15-16,25-28,30-32H2,(H2,44,50)(H,46,48)/t38-,40-/m1/s1 |
| InChIKey | NEWSFLSHIIRFPW-NPTUGSORSA-N |
| XLogP | 6.98 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.93 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|