C45H54N4O4 — CID 66858084
2-[(3S)-1-[9-[[(2S)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 66858084) has the molecular formula C45H54N4O4 and a molecular weight of 714.95 g/mol. Its IUPAC name is 2-[(3S)-1-[9-[[(2S)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[(3S)-1-[9-[[(2S)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 66858084 |
| Molecular Formula | C45H54N4O4 |
| Molecular Weight | 714.95 g/mol |
| Exact Mass | 714.41 |
| IUPAC Name | 2-[(3S)-1-[9-[[(2S)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]nonyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | NC(=O)C(c1ccccc1)(c1ccccc1)[C@@H]1CCN(CCCCCCCCCNC[C@@H](O)c2ccc(OCc3ccccc3)c3[nH]c(=O)ccc23)C1 |
| InChI | InChI=1S/C45H54N4O4/c46-44(52)45(35-19-11-7-12-20-35,36-21-13-8-14-22-36)37-27-30-49(32-37)29-16-5-3-1-2-4-15-28-47-31-40(50)38-23-25-41(43-39(38)24-26-42(51)48-43)53-33-34-17-9-6-10-18-34/h6-14,17-26,37,40,47,50H,1-5,15-16,27-33H2,(H2,46,52)(H,48,51)/t37-,40-/m1/s1 |
| InChIKey | SNYCUKLRPKLJFP-PILPWRDFSA-N |
| XLogP | 7.25 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.95 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|