C45H54N4O5 — CID 66968051
[1-[9-[[2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 66968051) has the molecular formula C45H54N4O5 and a molecular weight of 730.95 g/mol. Its IUPAC name is [1-[9-[[2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[9-[[2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 66968051 |
| Molecular Formula | C45H54N4O5 |
| Molecular Weight | 730.95 g/mol |
| Exact Mass | 730.41 |
| IUPAC Name | [1-[9-[[2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)OC1CCN(CCCCCCCCCNCC(O)c2ccc(OCc3ccccc3)c3[nH]c(=O)ccc23)CC1 |
| InChI | InChI=1S/C45H54N4O5/c50-41(38-22-24-42(44-39(38)23-25-43(51)48-44)53-33-34-16-8-6-9-17-34)32-46-28-14-4-2-1-3-5-15-29-49-30-26-36(27-31-49)54-45(52)47-40-21-13-12-20-37(40)35-18-10-7-11-19-35/h6-13,16-25,36,41,46,50H,1-5,14-15,26-33H2,(H,47,52)(H,48,51) |
| InChIKey | ABMOVYMAJDYMIC-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.95 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|