C50H65N5O6Si — CID 66968287
[1-[3-[5-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]pentylamino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 66968287) has the molecular formula C50H65N5O6Si and a molecular weight of 860.19 g/mol. Its IUPAC name is [1-[3-[5-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]pentylamino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[3-[5-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]pentylamino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 66968287 |
| Molecular Formula | C50H65N5O6Si |
| Molecular Weight | 860.19 g/mol |
| Exact Mass | 859.47 |
| IUPAC Name | [1-[3-[5-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]pentylamino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC(CNCCCCCNC(=O)CCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C50H65N5O6Si/c1-50(2,3)62(4,5)61-45(41-23-25-44(48-42(41)24-26-47(57)54-48)59-36-37-17-9-6-10-18-37)35-51-30-15-8-16-31-52-46(56)29-34-55-32-27-39(28-33-55)60-49(58)53-43-22-14-13-21-40(43)38-19-11-7-12-20-38/h6-7,9-14,17-26,39,45,51H,8,15-16,27-36H2,1-5H3,(H,52,56)(H,53,58)(H,54,57) |
| InChIKey | ADXFQJIDSDGHNQ-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.19 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|