C40H60N4O4Si — CID 123578705
N-[[3-[[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]methyl]cyclohexyl]methyl]-3-piperidin-1-ylpropanamide (PubChem CID 123578705) has the molecular formula C40H60N4O4Si and a molecular weight of 689.03 g/mol. Its IUPAC name is N-[[3-[[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]methyl]cyclohexyl]methyl]-3-piperidin-1-ylpropanamide.
| Compound Name | N-[[3-[[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]methyl]cyclohexyl]methyl]-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 123578705 |
| Molecular Formula | C40H60N4O4Si |
| Molecular Weight | 689.03 g/mol |
| Exact Mass | 688.44 |
| IUPAC Name | N-[[3-[[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]methyl]cyclohexyl]methyl]-3-piperidin-1-ylpropanamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CNCC1CCCC(CNC(=O)CCN2CCCCC2)C1)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C40H60N4O4Si/c1-40(2,3)49(4,5)48-36(33-17-19-35(39-34(33)18-20-38(46)43-39)47-29-30-13-8-6-9-14-30)28-41-26-31-15-12-16-32(25-31)27-42-37(45)21-24-44-22-10-7-11-23-44/h6,8-9,13-14,17-20,31-32,36,41H,7,10-12,15-16,21-29H2,1-5H3,(H,42,45)(H,43,46)/t31?,32?,36-/m0/s1 |
| InChIKey | UWBIFAMHPPUEEI-RTRHYIFRSA-N |
| XLogP | 7.56 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.03 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|