C39H44N4O3Si — CID 69091787
4-[4-[2-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]benzonitrile (PubChem CID 69091787) has the molecular formula C39H44N4O3Si and a molecular weight of 644.89 g/mol. Its IUPAC name is 4-[4-[2-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]benzonitrile.
| Compound Name | 4-[4-[2-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]benzonitrile |
|---|---|
| PubChem CID | 69091787 |
| Molecular Formula | C39H44N4O3Si |
| Molecular Weight | 644.89 g/mol |
| Exact Mass | 644.32 |
| IUPAC Name | 4-[4-[2-[[2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]benzonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC(CNCCc1ccc(Nc2ccc(C#N)cc2)cc1)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C39H44N4O3Si/c1-39(2,3)47(4,5)46-36(26-41-24-23-28-11-15-31(16-12-28)42-32-17-13-29(25-40)14-18-32)33-19-21-35(38-34(33)20-22-37(44)43-38)45-27-30-9-7-6-8-10-30/h6-22,36,41-42H,23-24,26-27H2,1-5H3,(H,43,44) |
| InChIKey | KSLIEODSUMJGHE-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.89 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|