C36H38N4O4 — CID 66941449
1-[4-[2-[[(2S)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]-3-(3-phenylpropyl)urea (PubChem CID 66941449) has the molecular formula C36H38N4O4 and a molecular weight of 590.72 g/mol. Its IUPAC name is 1-[4-[2-[[(2S)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]-3-(3-phenylpropyl)urea.
| Compound Name | 1-[4-[2-[[(2S)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]-3-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 66941449 |
| Molecular Formula | C36H38N4O4 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | 1-[4-[2-[[(2S)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]-3-(3-phenylpropyl)urea |
| SMILES | O=C(NCCCc1ccccc1)Nc1ccc(CCNC[C@@H](O)c2ccc(OCc3ccccc3)c3[nH]c(=O)ccc23)cc1 |
| InChI | InChI=1S/C36H38N4O4/c41-32(30-17-19-33(35-31(30)18-20-34(42)40-35)44-25-28-10-5-2-6-11-28)24-37-23-21-27-13-15-29(16-14-27)39-36(43)38-22-7-12-26-8-3-1-4-9-26/h1-6,8-11,13-20,32,37,41H,7,12,21-25H2,(H,40,42)(H2,38,39,43)/t32-/m1/s1 |
| InChIKey | YTCFXWKIVZFUDT-JGCGQSQUSA-N |
| XLogP | 5.73 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|