C34H36N4O3 — CID 66796190
5-[(1R)-2-[2-[4-[4-(2-aminoethyl)anilino]phenyl]ethylamino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one (PubChem CID 66796190) has the molecular formula C34H36N4O3 and a molecular weight of 548.69 g/mol. Its IUPAC name is 5-[(1R)-2-[2-[4-[4-(2-aminoethyl)anilino]phenyl]ethylamino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-[2-[4-[4-(2-aminoethyl)anilino]phenyl]ethylamino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 66796190 |
| Molecular Formula | C34H36N4O3 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | 5-[(1R)-2-[2-[4-[4-(2-aminoethyl)anilino]phenyl]ethylamino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
| SMILES | NCCc1ccc(Nc2ccc(CCNC[C@H](O)c3ccc(OCc4ccccc4)c4[nH]c(=O)ccc34)cc2)cc1 |
| InChI | InChI=1S/C34H36N4O3/c35-20-18-24-6-10-27(11-7-24)37-28-12-8-25(9-13-28)19-21-36-22-31(39)29-14-16-32(34-30(29)15-17-33(40)38-34)41-23-26-4-2-1-3-5-26/h1-17,31,36-37,39H,18-23,35H2,(H,38,40)/t31-/m0/s1 |
| InChIKey | SJLJTCZGOPBICN-HKBQPEDESA-N |
| XLogP | 5.22 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|