C39H36N2O5 — CID 68545832
5-[(1R)-1-hydroxy-2-[2-[4-(4-methoxy-3-phenylphenoxy)phenyl]ethylamino]ethyl]-8-phenylmethoxy-1H-quinolin-2-one (PubChem CID 68545832) has the molecular formula C39H36N2O5 and a molecular weight of 612.73 g/mol. Its IUPAC name is 5-[(1R)-1-hydroxy-2-[2-[4-(4-methoxy-3-phenylphenoxy)phenyl]ethylamino]ethyl]-8-phenylmethoxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-1-hydroxy-2-[2-[4-(4-methoxy-3-phenylphenoxy)phenyl]ethylamino]ethyl]-8-phenylmethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 68545832 |
| Molecular Formula | C39H36N2O5 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | 5-[(1R)-1-hydroxy-2-[2-[4-(4-methoxy-3-phenylphenoxy)phenyl]ethylamino]ethyl]-8-phenylmethoxy-1H-quinolin-2-one |
| SMILES | COc1ccc(Oc2ccc(CCNC[C@H](O)c3ccc(OCc4ccccc4)c4[nH]c(=O)ccc34)cc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C39H36N2O5/c1-44-36-19-16-31(24-34(36)29-10-6-3-7-11-29)46-30-14-12-27(13-15-30)22-23-40-25-35(42)32-17-20-37(39-33(32)18-21-38(43)41-39)45-26-28-8-4-2-5-9-28/h2-21,24,35,40,42H,22-23,25-26H2,1H3,(H,41,43)/t35-/m0/s1 |
| InChIKey | QMFBJKFAEXCSKR-DHUJRADRSA-N |
| XLogP | 7.44 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|