C35H36N4O4 — CID 91481153
1-[3-[2-[[2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]-3-(2-phenylethyl)urea (PubChem CID 91481153) has the molecular formula C35H36N4O4 and a molecular weight of 576.70 g/mol. Its IUPAC name is 1-[3-[2-[[2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]-3-(2-phenylethyl)urea.
| Compound Name | 1-[3-[2-[[2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 91481153 |
| Molecular Formula | C35H36N4O4 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 1-[3-[2-[[2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]-3-(2-phenylethyl)urea |
| SMILES | O=C(NCCc1ccccc1)Nc1cccc(CCNCC(O)c2ccc(OCc3ccccc3)c3[nH]c(=O)ccc23)c1 |
| InChI | InChI=1S/C35H36N4O4/c40-31(29-14-16-32(34-30(29)15-17-33(41)39-34)43-24-27-10-5-2-6-11-27)23-36-20-18-26-12-7-13-28(22-26)38-35(42)37-21-19-25-8-3-1-4-9-25/h1-17,22,31,36,40H,18-21,23-24H2,(H,39,41)(H2,37,38,42) |
| InChIKey | OYKOQVALZZWKED-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|