C28H29N5O5 — CID 53323515
3-[[[3-[2-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]carbamoylamino]methyl]benzamide (PubChem CID 53323515) has the molecular formula C28H29N5O5 and a molecular weight of 515.57 g/mol. Its IUPAC name is 3-[[[3-[2-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]carbamoylamino]methyl]benzamide.
| Compound Name | 3-[[[3-[2-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]carbamoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 53323515 |
| Molecular Formula | C28H29N5O5 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 3-[[[3-[2-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]carbamoylamino]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNC(=O)Nc2cccc(CCNCC(O)c3ccc(O)c4[nH]c(=O)ccc34)c2)c1 |
| InChI | InChI=1S/C28H29N5O5/c29-27(37)19-5-1-4-18(13-19)15-31-28(38)32-20-6-2-3-17(14-20)11-12-30-16-24(35)21-7-9-23(34)26-22(21)8-10-25(36)33-26/h1-10,13-14,24,30,34-35H,11-12,15-16H2,(H2,29,37)(H,33,36)(H2,31,32,38) |
| InChIKey | MRCYQSIJZLOQPB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 169.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|