C27H37N3O6S — CID 10075724
3-[4-[6-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]butyl]benzenesulfonamide (PubChem CID 10075724) has the molecular formula C27H37N3O6S and a molecular weight of 531.68 g/mol. Its IUPAC name is 3-[4-[6-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]butyl]benzenesulfonamide.
| Compound Name | 3-[4-[6-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10075724 |
| Molecular Formula | C27H37N3O6S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 3-[4-[6-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]butyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(CCCCOCCCCCCNC[C@H](O)c2ccc(O)c3[nH]c(=O)ccc23)c1 |
| InChI | InChI=1S/C27H37N3O6S/c28-37(34,35)21-10-7-9-20(18-21)8-3-6-17-36-16-5-2-1-4-15-29-19-25(32)22-11-13-24(31)27-23(22)12-14-26(33)30-27/h7,9-14,18,25,29,31-32H,1-6,8,15-17,19H2,(H,30,33)(H2,28,34,35)/t25-/m0/s1 |
| InChIKey | NGJFBAIXCBGIOJ-VWLOTQADSA-N |
| XLogP | 3.10 |
| TPSA | 154.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|