C21H32N2O3 — CID 91244472
5-[2-(decylamino)-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 91244472) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 5-[2-(decylamino)-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[2-(decylamino)-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 91244472 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 5-[2-(decylamino)-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | CCCCCCCCCCNCC(O)c1ccc(O)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C21H32N2O3/c1-2-3-4-5-6-7-8-9-14-22-15-19(25)16-10-12-18(24)21-17(16)11-13-20(26)23-21/h10-13,19,22,24-25H,2-9,14-15H2,1H3,(H,23,26) |
| InChIKey | TYMXWNWKLLXHFV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|