C26H37N3O4 — CID 122698474
5-[(1R)-2-[6-[2-[cyclohex-3-yn-1-yl(methyl)amino]ethoxy]hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 122698474) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is 5-[(1R)-2-[6-[2-[cyclohex-3-yn-1-yl(methyl)amino]ethoxy]hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-[6-[2-[cyclohex-3-yn-1-yl(methyl)amino]ethoxy]hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 122698474 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 5-[(1R)-2-[6-[2-[cyclohex-3-yn-1-yl(methyl)amino]ethoxy]hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | CN(CCOCCCCCCNC[C@H](O)c1ccc(O)c2[nH]c(=O)ccc12)C1CC#CCC1 |
| InChI | InChI=1S/C26H37N3O4/c1-29(20-9-5-4-6-10-20)16-18-33-17-8-3-2-7-15-27-19-24(31)21-11-13-23(30)26-22(21)12-14-25(32)28-26/h11-14,20,24,27,30-31H,2-3,5,7-10,15-19H2,1H3,(H,28,32)/t20?,24-/m0/s1 |
| InChIKey | CPZPOPJZDSCFGS-JWIMYKKASA-N |
| XLogP | 2.92 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|