C25H32F2N2O4 — CID 154386943
5-[(1R)-2-[6-[2-(6,6-difluorocyclohexa-2,4-dien-1-yl)ethoxy]hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 154386943) has the molecular formula C25H32F2N2O4 and a molecular weight of 462.54 g/mol. Its IUPAC name is 5-[(1R)-2-[6-[2-(6,6-difluorocyclohexa-2,4-dien-1-yl)ethoxy]hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-[6-[2-(6,6-difluorocyclohexa-2,4-dien-1-yl)ethoxy]hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 154386943 |
| Molecular Formula | C25H32F2N2O4 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 5-[(1R)-2-[6-[2-(6,6-difluorocyclohexa-2,4-dien-1-yl)ethoxy]hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | O=c1ccc2c([C@@H](O)CNCCCCCCOCCC3C=CC=CC3(F)F)ccc(O)c2[nH]1 |
| InChI | InChI=1S/C25H32F2N2O4/c26-25(27)13-4-3-7-18(25)12-16-33-15-6-2-1-5-14-28-17-22(31)19-8-10-21(30)24-20(19)9-11-23(32)29-24/h3-4,7-11,13,18,22,28,30-31H,1-2,5-6,12,14-17H2,(H,29,32)/t18?,22-/m0/s1 |
| InChIKey | XIRWBTJPKJAREV-YSYXNDDBSA-N |
| XLogP | 4.20 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|