C26H41N5O4 — CID 91361078
[1-[9-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonyl]piperidin-4-yl]urea (PubChem CID 91361078) has the molecular formula C26H41N5O4 and a molecular weight of 487.65 g/mol. Its IUPAC name is [1-[9-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonyl]piperidin-4-yl]urea.
| Compound Name | [1-[9-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 91361078 |
| Molecular Formula | C26H41N5O4 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | [1-[9-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonyl]piperidin-4-yl]urea |
| SMILES | NC(=O)NC1CCN(CCCCCCCCCNCC(O)c2ccc(O)c3[nH]c(=O)ccc23)CC1 |
| InChI | InChI=1S/C26H41N5O4/c27-26(35)29-19-12-16-31(17-13-19)15-7-5-3-1-2-4-6-14-28-18-23(33)20-8-10-22(32)25-21(20)9-11-24(34)30-25/h8-11,19,23,28,32-33H,1-7,12-18H2,(H,30,34)(H3,27,29,35) |
| InChIKey | JFYABWVZRRUMNW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|