C24H37N5O4 — CID 160615918
1-[5-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]pentyl]-3-(2-piperidin-1-ylethyl)urea (PubChem CID 160615918) has the molecular formula C24H37N5O4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 1-[5-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]pentyl]-3-(2-piperidin-1-ylethyl)urea.
| Compound Name | 1-[5-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]pentyl]-3-(2-piperidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 160615918 |
| Molecular Formula | C24H37N5O4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 1-[5-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]pentyl]-3-(2-piperidin-1-ylethyl)urea |
| SMILES | O=C(NCCCCCNC[C@H](O)c1ccc(O)c2[nH]c(=O)ccc12)NCCN1CCCCC1 |
| InChI | InChI=1S/C24H37N5O4/c30-20-9-7-18(19-8-10-22(32)28-23(19)20)21(31)17-25-11-3-1-4-12-26-24(33)27-13-16-29-14-5-2-6-15-29/h7-10,21,25,30-31H,1-6,11-17H2,(H,28,32)(H2,26,27,33)/t21-/m0/s1 |
| InChIKey | XNJNVQDKMHMJID-NRFANRHFSA-N |
| XLogP | 1.81 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|