C25H39N3O3 — CID 151406566
8-hydroxy-5-[(1R)-1-hydroxy-2-(9-piperidin-1-ylnonylamino)ethyl]-1H-quinolin-2-one (PubChem CID 151406566) has the molecular formula C25H39N3O3 and a molecular weight of 429.61 g/mol. Its IUPAC name is 8-hydroxy-5-[(1R)-1-hydroxy-2-(9-piperidin-1-ylnonylamino)ethyl]-1H-quinolin-2-one.
| Compound Name | 8-hydroxy-5-[(1R)-1-hydroxy-2-(9-piperidin-1-ylnonylamino)ethyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 151406566 |
| Molecular Formula | C25H39N3O3 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | 8-hydroxy-5-[(1R)-1-hydroxy-2-(9-piperidin-1-ylnonylamino)ethyl]-1H-quinolin-2-one |
| SMILES | O=c1ccc2c([C@@H](O)CNCCCCCCCCCN3CCCCC3)ccc(O)c2[nH]1 |
| InChI | InChI=1S/C25H39N3O3/c29-22-13-11-20(21-12-14-24(31)27-25(21)22)23(30)19-26-15-7-4-2-1-3-5-8-16-28-17-9-6-10-18-28/h11-14,23,26,29-30H,1-10,15-19H2,(H,27,31)/t23-/m0/s1 |
| InChIKey | OXPXZUUTKUULRE-QHCPKHFHSA-N |
| XLogP | 4.07 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|