C60H66F4N4O12S2-2 — CID 25065408
bis(5-[2-[6-(2,2-difluoro-2-phenylethoxy)hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one);naphthalene-1,5-disulfinate (PubChem CID 25065408) has the molecular formula C60H66F4N4O12S2-2 and a molecular weight of 1175.33 g/mol. Its IUPAC name is bis(5-[2-[6-(2,2-difluoro-2-phenylethoxy)hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one);naphthalene-1,5-disulfinate.
| Compound Name | bis(5-[2-[6-(2,2-difluoro-2-phenylethoxy)hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one);naphthalene-1,5-disulfinate |
|---|---|
| PubChem CID | 25065408 |
| Molecular Formula | C60H66F4N4O12S2-2 |
| Molecular Weight | 1175.33 g/mol |
| Exact Mass | 1174.41 |
| IUPAC Name | bis(5-[2-[6-(2,2-difluoro-2-phenylethoxy)hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one);naphthalene-1,5-disulfinate |
| SMILES | O=S([O-])c1cccc2c(S(=O)[O-])cccc12.O=c1ccc2c(C(O)CNCCCCCCOCC(F)(F)c3ccccc3)ccc(O)c2[nH]1.O=c1ccc2c(C(O)CNCCCCCCOCC(F)(F)c3ccccc3)ccc(O)c2[nH]1 |
| InChI | InChI=1S/2C25H30F2N2O4.C10H8O4S2/c2*26-25(27,18-8-4-3-5-9-18)17-33-15-7-2-1-6-14-28-16-22(31)19-10-12-21(30)24-20(19)11-13-23(32)29-24;11-15(12)9-5-1-3-7-8(9)4-2-6-10(7)16(13)14/h2*3-5,8-13,22,28,30-31H,1-2,6-7,14-17H2,(H,29,32);1-6H,(H,11,12)(H,13,14)/p-2 |
| InChIKey | MEIAUGQPQSNZAN-UHFFFAOYSA-L |
| XLogP | 9.77 |
| TPSA | 269.42 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 82 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1175.33 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|