C31H34N2O7 — CID 175043855
2-hydroxy-2-[3-[6-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]phenyl]-2-phenylacetic acid (PubChem CID 175043855) has the molecular formula C31H34N2O7 and a molecular weight of 546.62 g/mol. Its IUPAC name is 2-hydroxy-2-[3-[6-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]phenyl]-2-phenylacetic acid.
| Compound Name | 2-hydroxy-2-[3-[6-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]phenyl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 175043855 |
| Molecular Formula | C31H34N2O7 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 2-hydroxy-2-[3-[6-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]phenyl]-2-phenylacetic acid |
| SMILES | O=C(O)C(O)(c1ccccc1)c1cccc(OCCCCCCNCC(O)c2ccc(O)c3[nH]c(=O)ccc23)c1 |
| InChI | InChI=1S/C31H34N2O7/c34-26-15-13-24(25-14-16-28(36)33-29(25)26)27(35)20-32-17-6-1-2-7-18-40-23-12-8-11-22(19-23)31(39,30(37)38)21-9-4-3-5-10-21/h3-5,8-16,19,27,32,34-35,39H,1-2,6-7,17-18,20H2,(H,33,36)(H,37,38) |
| InChIKey | PWDLURNMKYVSDU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|