C46H56N4O6 — CID 71256892
[(1-benzylpiperidin-4-yl)-[3-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]-phenylmethyl]carbamic acid (PubChem CID 71256892) has the molecular formula C46H56N4O6 and a molecular weight of 760.98 g/mol. Its IUPAC name is [(1-benzylpiperidin-4-yl)-[3-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]-phenylmethyl]carbamic acid.
| Compound Name | [(1-benzylpiperidin-4-yl)-[3-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]-phenylmethyl]carbamic acid |
|---|---|
| PubChem CID | 71256892 |
| Molecular Formula | C46H56N4O6 |
| Molecular Weight | 760.98 g/mol |
| Exact Mass | 760.42 |
| IUPAC Name | [(1-benzylpiperidin-4-yl)-[3-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]-phenylmethyl]carbamic acid |
| SMILES | O=C(O)NC(c1ccccc1)(c1cccc(OCCCCCCCCCNC[C@H](O)c2ccc(O)c3[nH]c(=O)ccc23)c1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C46H56N4O6/c51-41-23-21-39(40-22-24-43(53)48-44(40)41)42(52)32-47-27-12-4-2-1-3-5-13-30-56-38-20-14-19-37(31-38)46(49-45(54)55,35-17-10-7-11-18-35)36-25-28-50(29-26-36)33-34-15-8-6-9-16-34/h6-11,14-24,31,36,42,47,49,51-52H,1-5,12-13,25-30,32-33H2,(H,48,53)(H,54,55)/t42-,46?/m0/s1 |
| InChIKey | YHXCKVMBHBNOFI-WSYFDBJQSA-N |
| XLogP | 8.09 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.98 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|