C34H40ClN3O6 — CID 118364082
(3-chlorophenyl)methyl-[3-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]carbamic acid (PubChem CID 118364082) has the molecular formula C34H40ClN3O6 and a molecular weight of 622.16 g/mol. Its IUPAC name is (3-chlorophenyl)methyl-[3-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]carbamic acid.
| Compound Name | (3-chlorophenyl)methyl-[3-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]carbamic acid |
|---|---|
| PubChem CID | 118364082 |
| Molecular Formula | C34H40ClN3O6 |
| Molecular Weight | 622.16 g/mol |
| Exact Mass | 621.26 |
| IUPAC Name | (3-chlorophenyl)methyl-[3-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]carbamic acid |
| SMILES | O=C(O)N(Cc1cccc(Cl)c1)c1cccc(OCCCCCCCCCNC[C@H](O)c2ccc(O)c3[nH]c(=O)ccc23)c1 |
| InChI | InChI=1S/C34H40ClN3O6/c35-25-11-8-10-24(20-25)23-38(34(42)43)26-12-9-13-27(21-26)44-19-7-5-3-1-2-4-6-18-36-22-31(40)28-14-16-30(39)33-29(28)15-17-32(41)37-33/h8-17,20-21,31,36,39-40H,1-7,18-19,22-23H2,(H,37,41)(H,42,43)/t31-/m0/s1 |
| InChIKey | GCMMQILAWOBJBB-HKBQPEDESA-N |
| XLogP | 7.00 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.16 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|