C29H33N3O6S — CID 118364089
[[3-[6-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]phenyl]-thiophen-2-ylmethyl]carbamic acid (PubChem CID 118364089) has the molecular formula C29H33N3O6S and a molecular weight of 551.67 g/mol. Its IUPAC name is [[3-[6-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]phenyl]-thiophen-2-ylmethyl]carbamic acid.
| Compound Name | [[3-[6-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]phenyl]-thiophen-2-ylmethyl]carbamic acid |
|---|---|
| PubChem CID | 118364089 |
| Molecular Formula | C29H33N3O6S |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | [[3-[6-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]phenyl]-thiophen-2-ylmethyl]carbamic acid |
| SMILES | O=C(O)NC(c1cccc(OCCCCCCNCC(O)c2ccc(O)c3[nH]c(=O)ccc23)c1)c1cccs1 |
| InChI | InChI=1S/C29H33N3O6S/c33-23-12-10-21(22-11-13-26(35)31-28(22)23)24(34)18-30-14-3-1-2-4-15-38-20-8-5-7-19(17-20)27(32-29(36)37)25-9-6-16-39-25/h5-13,16-17,24,27,30,32-34H,1-4,14-15,18H2,(H,31,35)(H,36,37) |
| InChIKey | KAUXESUWORUNRB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|