C34H39F2N3O6 — CID 71093384
[(3,5-difluorophenyl)-[3-[9-[[(2S)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]methyl]carbamic acid (PubChem CID 71093384) has the molecular formula C34H39F2N3O6 and a molecular weight of 623.70 g/mol. Its IUPAC name is [(3,5-difluorophenyl)-[3-[9-[[(2S)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]methyl]carbamic acid.
| Compound Name | [(3,5-difluorophenyl)-[3-[9-[[(2S)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]methyl]carbamic acid |
|---|---|
| PubChem CID | 71093384 |
| Molecular Formula | C34H39F2N3O6 |
| Molecular Weight | 623.70 g/mol |
| Exact Mass | 623.28 |
| IUPAC Name | [(3,5-difluorophenyl)-[3-[9-[[(2S)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]methyl]carbamic acid |
| SMILES | O=C(O)NC(c1cc(F)cc(F)c1)c1cccc(OCCCCCCCCCNC[C@@H](O)c2ccc(O)c3[nH]c(=O)ccc23)c1 |
| InChI | InChI=1S/C34H39F2N3O6/c35-24-17-23(18-25(36)20-24)32(39-34(43)44)22-9-8-10-26(19-22)45-16-7-5-3-1-2-4-6-15-37-21-30(41)27-11-13-29(40)33-28(27)12-14-31(42)38-33/h8-14,17-20,30,32,37,39-41H,1-7,15-16,21H2,(H,38,42)(H,43,44)/t30-,32?/m1/s1 |
| InChIKey | PVWYFHRDVFWPIR-VETVTEPKSA-N |
| XLogP | 6.30 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|