C34H41N3O6 — CID 118364097
[3-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]methyl-phenylcarbamic acid (PubChem CID 118364097) has the molecular formula C34H41N3O6 and a molecular weight of 587.72 g/mol. Its IUPAC name is [3-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]methyl-phenylcarbamic acid.
| Compound Name | [3-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]methyl-phenylcarbamic acid |
|---|---|
| PubChem CID | 118364097 |
| Molecular Formula | C34H41N3O6 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | [3-[9-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]nonoxy]phenyl]methyl-phenylcarbamic acid |
| SMILES | O=C(O)N(Cc1cccc(OCCCCCCCCCNC[C@H](O)c2ccc(O)c3[nH]c(=O)ccc23)c1)c1ccccc1 |
| InChI | InChI=1S/C34H41N3O6/c38-30-18-16-28(29-17-19-32(40)36-33(29)30)31(39)23-35-20-9-4-2-1-3-5-10-21-43-27-15-11-12-25(22-27)24-37(34(41)42)26-13-7-6-8-14-26/h6-8,11-19,22,31,35,38-39H,1-5,9-10,20-21,23-24H2,(H,36,40)(H,41,42)/t31-/m0/s1 |
| InChIKey | WEUYVMWPAJGGGN-HKBQPEDESA-N |
| XLogP | 6.35 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|