C36H46F2N4O6 — CID 118513215
(4-aminocyclohexyl)-[5-[6-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]-2-phenylphenyl]carbamic acid;dihydrofluoride (PubChem CID 118513215) has the molecular formula C36H46F2N4O6 and a molecular weight of 668.78 g/mol. Its IUPAC name is (4-aminocyclohexyl)-[5-[6-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]-2-phenylphenyl]carbamic acid;dihydrofluoride.
| Compound Name | (4-aminocyclohexyl)-[5-[6-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]-2-phenylphenyl]carbamic acid;dihydrofluoride |
|---|---|
| PubChem CID | 118513215 |
| Molecular Formula | C36H46F2N4O6 |
| Molecular Weight | 668.78 g/mol |
| Exact Mass | 668.34 |
| IUPAC Name | (4-aminocyclohexyl)-[5-[6-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]hexoxy]-2-phenylphenyl]carbamic acid;dihydrofluoride |
| SMILES | F.F.NC1CCC(N(C(=O)O)c2cc(OCCCCCCNC[C@H](O)c3ccc(O)c4[nH]c(=O)ccc34)ccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C36H44N4O6.2FH/c37-25-10-12-26(13-11-25)40(36(44)45)31-22-27(14-15-28(31)24-8-4-3-5-9-24)46-21-7-2-1-6-20-38-23-33(42)29-16-18-32(41)35-30(29)17-19-34(43)39-35;;/h3-5,8-9,14-19,22,25-26,33,38,41-42H,1-2,6-7,10-13,20-21,23,37H2,(H,39,43)(H,44,45);2*1H/t25?,26?,33-;;/m0../s1 |
| InChIKey | BMKGVTINGBNSSW-VQRHJKDJSA-N |
| XLogP | 6.22 |
| TPSA | 161.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.78 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|