C35H35N3O5 — CID 71093322
4-[(3-benzylphenoxy)methyl]-N-[3-[[(2S)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]propyl]benzamide (PubChem CID 71093322) has the molecular formula C35H35N3O5 and a molecular weight of 577.68 g/mol. Its IUPAC name is 4-[(3-benzylphenoxy)methyl]-N-[3-[[(2S)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]propyl]benzamide.
| Compound Name | 4-[(3-benzylphenoxy)methyl]-N-[3-[[(2S)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 71093322 |
| Molecular Formula | C35H35N3O5 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 4-[(3-benzylphenoxy)methyl]-N-[3-[[(2S)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]propyl]benzamide |
| SMILES | O=C(NCCCNC[C@@H](O)c1ccc(O)c2[nH]c(=O)ccc12)c1ccc(COc2cccc(Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C35H35N3O5/c39-31-16-14-29(30-15-17-33(41)38-34(30)31)32(40)22-36-18-5-19-37-35(42)27-12-10-25(11-13-27)23-43-28-9-4-8-26(21-28)20-24-6-2-1-3-7-24/h1-4,6-17,21,32,36,39-40H,5,18-20,22-23H2,(H,37,42)(H,38,41)/t32-/m1/s1 |
| InChIKey | RBFSZGCXPVJXMN-JGCGQSQUSA-N |
| XLogP | 4.85 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|