C28H27F2NO4 — CID 157123590
5-[5-[3-(2,2-difluoro-2-phenylethoxy)phenyl]-1-hydroxypentyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 157123590) has the molecular formula C28H27F2NO4 and a molecular weight of 479.52 g/mol. Its IUPAC name is 5-[5-[3-(2,2-difluoro-2-phenylethoxy)phenyl]-1-hydroxypentyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[5-[3-(2,2-difluoro-2-phenylethoxy)phenyl]-1-hydroxypentyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 157123590 |
| Molecular Formula | C28H27F2NO4 |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 5-[5-[3-(2,2-difluoro-2-phenylethoxy)phenyl]-1-hydroxypentyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | O=c1ccc2c(C(O)CCCCc3cccc(OCC(F)(F)c4ccccc4)c3)ccc(O)c2[nH]1 |
| InChI | InChI=1S/C28H27F2NO4/c29-28(30,20-9-2-1-3-10-20)18-35-21-11-6-8-19(17-21)7-4-5-12-24(32)22-13-15-25(33)27-23(22)14-16-26(34)31-27/h1-3,6,8-11,13-17,24,32-33H,4-5,7,12,18H2,(H,31,34) |
| InChIKey | AIGJDKDNKGEFEX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|