C35H33NO4 — CID 58123436
8-hydroxy-5-[1-hydroxy-5-[3-[2-oxo-3-(4-phenylphenyl)propyl]phenyl]pentyl]-1H-quinolin-2-one (PubChem CID 58123436) has the molecular formula C35H33NO4 and a molecular weight of 531.65 g/mol. Its IUPAC name is 8-hydroxy-5-[1-hydroxy-5-[3-[2-oxo-3-(4-phenylphenyl)propyl]phenyl]pentyl]-1H-quinolin-2-one.
| Compound Name | 8-hydroxy-5-[1-hydroxy-5-[3-[2-oxo-3-(4-phenylphenyl)propyl]phenyl]pentyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 58123436 |
| Molecular Formula | C35H33NO4 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 8-hydroxy-5-[1-hydroxy-5-[3-[2-oxo-3-(4-phenylphenyl)propyl]phenyl]pentyl]-1H-quinolin-2-one |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)Cc1cccc(CCCCC(O)c2ccc(O)c3[nH]c(=O)ccc23)c1 |
| InChI | InChI=1S/C35H33NO4/c37-29(22-25-13-15-28(16-14-25)27-10-2-1-3-11-27)23-26-9-6-8-24(21-26)7-4-5-12-32(38)30-17-19-33(39)35-31(30)18-20-34(40)36-35/h1-3,6,8-11,13-21,32,38-39H,4-5,7,12,22-23H2,(H,36,40) |
| InChIKey | FNHJKKQIQYIGCV-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|