C31H36N2O4 — CID 58289470
5-[(1S)-5-[4-[4-(2,2-dimethylpropoxy)anilino]phenyl]-1-hydroxypentyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 58289470) has the molecular formula C31H36N2O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is 5-[(1S)-5-[4-[4-(2,2-dimethylpropoxy)anilino]phenyl]-1-hydroxypentyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[(1S)-5-[4-[4-(2,2-dimethylpropoxy)anilino]phenyl]-1-hydroxypentyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 58289470 |
| Molecular Formula | C31H36N2O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 5-[(1S)-5-[4-[4-(2,2-dimethylpropoxy)anilino]phenyl]-1-hydroxypentyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | CC(C)(C)COc1ccc(Nc2ccc(CCCC[C@H](O)c3ccc(O)c4[nH]c(=O)ccc34)cc2)cc1 |
| InChI | InChI=1S/C31H36N2O4/c1-31(2,3)20-37-24-14-12-23(13-15-24)32-22-10-8-21(9-11-22)6-4-5-7-27(34)25-16-18-28(35)30-26(25)17-19-29(36)33-30/h8-19,27,32,34-35H,4-7,20H2,1-3H3,(H,33,36)/t27-/m0/s1 |
| InChIKey | URIPIEDNGGXYEE-MHZLTWQESA-N |
| XLogP | 6.85 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|