C28H31N5O3 — CID 11576708
4-[4-[2-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]-N,N-dimethylbenzenecarboximidamide (PubChem CID 11576708) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is 4-[4-[2-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]-N,N-dimethylbenzenecarboximidamide.
| Compound Name | 4-[4-[2-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]-N,N-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 11576708 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 4-[4-[2-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]-N,N-dimethylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1ccc(Nc2ccc(CCNC[C@H](O)c3ccc(O)c4[nH]c(=O)ccc34)cc2)cc1)N(C)C |
| InChI | InChI=1S/C28H31N5O3/c1-33(2)28(29)19-5-9-21(10-6-19)31-20-7-3-18(4-8-20)15-16-30-17-25(35)22-11-13-24(34)27-23(22)12-14-26(36)32-27/h3-14,25,29-31,34-35H,15-17H2,1-2H3,(H,32,36)/b29-28-/t25-/m0/s1 |
| InChIKey | FRWBQLCUMNONCF-WEBDSESRSA-N |
| XLogP | 3.73 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|