C31H28ClN3O3 — CID 10152667
5-[(1R)-2-[2-[4-[3-(2-chlorophenyl)anilino]phenyl]ethylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 10152667) has the molecular formula C31H28ClN3O3 and a molecular weight of 526.04 g/mol. Its IUPAC name is 5-[(1R)-2-[2-[4-[3-(2-chlorophenyl)anilino]phenyl]ethylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-[2-[4-[3-(2-chlorophenyl)anilino]phenyl]ethylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10152667 |
| Molecular Formula | C31H28ClN3O3 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 5-[(1R)-2-[2-[4-[3-(2-chlorophenyl)anilino]phenyl]ethylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | O=c1ccc2c([C@@H](O)CNCCc3ccc(Nc4cccc(-c5ccccc5Cl)c4)cc3)ccc(O)c2[nH]1 |
| InChI | InChI=1S/C31H28ClN3O3/c32-27-7-2-1-6-24(27)21-4-3-5-23(18-21)34-22-10-8-20(9-11-22)16-17-33-19-29(37)25-12-14-28(36)31-26(25)13-15-30(38)35-31/h1-15,18,29,33-34,36-37H,16-17,19H2,(H,35,38)/t29-/m0/s1 |
| InChIKey | LZZOJKLDFNTQBD-LJAQVGFWSA-N |
| XLogP | 6.16 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|