C34H35N3O5 — CID 11606558
5-[2-[2-[4-[3-[3-(2-aminoethyl)phenyl]-4-methoxyphenoxy]phenyl]ethylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 11606558) has the molecular formula C34H35N3O5 and a molecular weight of 565.67 g/mol. Its IUPAC name is 5-[2-[2-[4-[3-[3-(2-aminoethyl)phenyl]-4-methoxyphenoxy]phenyl]ethylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[2-[2-[4-[3-[3-(2-aminoethyl)phenyl]-4-methoxyphenoxy]phenyl]ethylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 11606558 |
| Molecular Formula | C34H35N3O5 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 5-[2-[2-[4-[3-[3-(2-aminoethyl)phenyl]-4-methoxyphenoxy]phenyl]ethylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | COc1ccc(Oc2ccc(CCNCC(O)c3ccc(O)c4[nH]c(=O)ccc34)cc2)cc1-c1cccc(CCN)c1 |
| InChI | InChI=1S/C34H35N3O5/c1-41-32-13-9-26(20-29(32)24-4-2-3-23(19-24)15-17-35)42-25-7-5-22(6-8-25)16-18-36-21-31(39)27-10-12-30(38)34-28(27)11-14-33(40)37-34/h2-14,19-20,31,36,38-39H,15-18,21,35H2,1H3,(H,37,40) |
| InChIKey | XJFXXNRPCNSPIJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|