C31H29N3O3 — CID 90901841
5-[2-[2-[2-amino-4-(3-phenylphenyl)phenyl]ethylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 90901841) has the molecular formula C31H29N3O3 and a molecular weight of 491.59 g/mol. Its IUPAC name is 5-[2-[2-[2-amino-4-(3-phenylphenyl)phenyl]ethylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[2-[2-[2-amino-4-(3-phenylphenyl)phenyl]ethylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 90901841 |
| Molecular Formula | C31H29N3O3 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 5-[2-[2-[2-amino-4-(3-phenylphenyl)phenyl]ethylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | Nc1cc(-c2cccc(-c3ccccc3)c2)ccc1CCNCC(O)c1ccc(O)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C31H29N3O3/c32-27-18-24(23-8-4-7-22(17-23)20-5-2-1-3-6-20)10-9-21(27)15-16-33-19-29(36)25-11-13-28(35)31-26(25)12-14-30(37)34-31/h1-14,17-18,29,33,35-36H,15-16,19,32H2,(H,34,37) |
| InChIKey | FJAKFECJAYITCF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|