C27H35Cl2N3O4 — CID 67455251
5-[2-[6-[2-[2-(2,6-dichlorophenyl)ethylamino]ethoxy]hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 67455251) has the molecular formula C27H35Cl2N3O4 and a molecular weight of 536.50 g/mol. Its IUPAC name is 5-[2-[6-[2-[2-(2,6-dichlorophenyl)ethylamino]ethoxy]hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[2-[6-[2-[2-(2,6-dichlorophenyl)ethylamino]ethoxy]hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 67455251 |
| Molecular Formula | C27H35Cl2N3O4 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 5-[2-[6-[2-[2-(2,6-dichlorophenyl)ethylamino]ethoxy]hexylamino]-1-hydroxyethyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | O=c1ccc2c(C(O)CNCCCCCCOCCNCCc3c(Cl)cccc3Cl)ccc(O)c2[nH]1 |
| InChI | InChI=1S/C27H35Cl2N3O4/c28-22-6-5-7-23(29)21(22)12-14-30-15-17-36-16-4-2-1-3-13-31-18-25(34)19-8-10-24(33)27-20(19)9-11-26(35)32-27/h5-11,25,30-31,33-34H,1-4,12-18H2,(H,32,35) |
| InChIKey | GSIJBNOVJXZYRD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|