C41H49N3O6S — CID 91072799
3-[4-[6-[[(1R)-1-hydroxy-1-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)-3-phenylpropan-2-yl]amino]hexoxy]butyl]benzenesulfonamide (PubChem CID 91072799) has the molecular formula C41H49N3O6S and a molecular weight of 711.93 g/mol. Its IUPAC name is 3-[4-[6-[[(1R)-1-hydroxy-1-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)-3-phenylpropan-2-yl]amino]hexoxy]butyl]benzenesulfonamide.
| Compound Name | 3-[4-[6-[[(1R)-1-hydroxy-1-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)-3-phenylpropan-2-yl]amino]hexoxy]butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91072799 |
| Molecular Formula | C41H49N3O6S |
| Molecular Weight | 711.93 g/mol |
| Exact Mass | 711.33 |
| IUPAC Name | 3-[4-[6-[[(1R)-1-hydroxy-1-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)-3-phenylpropan-2-yl]amino]hexoxy]butyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(CCCCOCCCCCCNC(Cc2ccccc2)[C@H](O)c2ccc(OCc3ccccc3)c3[nH]c(=O)ccc23)c1 |
| InChI | InChI=1S/C41H49N3O6S/c42-51(47,48)34-20-13-19-31(28-34)16-9-12-27-49-26-11-2-1-10-25-43-37(29-32-14-5-3-6-15-32)41(46)36-21-23-38(40-35(36)22-24-39(45)44-40)50-30-33-17-7-4-8-18-33/h3-8,13-15,17-24,28,37,41,43,46H,1-2,9-12,16,25-27,29-30H2,(H,44,45)(H2,42,47,48)/t37?,41-/m1/s1 |
| InChIKey | FYIAIJLSRAIISC-LSBRRTLXSA-N |
| XLogP | 6.59 |
| TPSA | 143.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.93 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|