C38H50F2N2O4Si — CID 89482842
5-[(1R)-2-[[tert-butyl(dimethyl)silyl]-[6-(2,2-difluoro-2-phenylethoxy)hexyl]amino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one (PubChem CID 89482842) has the molecular formula C38H50F2N2O4Si and a molecular weight of 664.91 g/mol. Its IUPAC name is 5-[(1R)-2-[[tert-butyl(dimethyl)silyl]-[6-(2,2-difluoro-2-phenylethoxy)hexyl]amino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-[[tert-butyl(dimethyl)silyl]-[6-(2,2-difluoro-2-phenylethoxy)hexyl]amino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 89482842 |
| Molecular Formula | C38H50F2N2O4Si |
| Molecular Weight | 664.91 g/mol |
| Exact Mass | 664.35 |
| IUPAC Name | 5-[(1R)-2-[[tert-butyl(dimethyl)silyl]-[6-(2,2-difluoro-2-phenylethoxy)hexyl]amino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)N(CCCCCCOCC(F)(F)c1ccccc1)C[C@H](O)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C38H50F2N2O4Si/c1-37(2,3)47(4,5)42(24-14-6-7-15-25-45-28-38(39,40)30-18-12-9-13-19-30)26-33(43)31-20-22-34(36-32(31)21-23-35(44)41-36)46-27-29-16-10-8-11-17-29/h8-13,16-23,33,43H,6-7,14-15,24-28H2,1-5H3,(H,41,44)/t33-/m0/s1 |
| InChIKey | ZWWZPMRSNHGFAC-XIFFEERXSA-N |
| XLogP | 8.82 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.91 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|