C42H56N2O8Si — CID 140855778
3-[6-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexoxy]benzoic acid (PubChem CID 140855778) has the molecular formula C42H56N2O8Si and a molecular weight of 745.00 g/mol. Its IUPAC name is 3-[6-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexoxy]benzoic acid.
| Compound Name | 3-[6-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexoxy]benzoic acid |
|---|---|
| PubChem CID | 140855778 |
| Molecular Formula | C42H56N2O8Si |
| Molecular Weight | 745.00 g/mol |
| Exact Mass | 744.38 |
| IUPAC Name | 3-[6-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexoxy]benzoic acid |
| SMILES | CC(C)(C)OC(=O)N(CCCCCCOc1cccc(C(=O)O)c1)C[C@H](O[Si](C)(C)C(C)(C)C)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C42H56N2O8Si/c1-41(2,3)51-40(48)44(25-14-9-10-15-26-49-32-20-16-19-31(27-32)39(46)47)28-36(52-53(7,8)42(4,5)6)33-21-23-35(38-34(33)22-24-37(45)43-38)50-29-30-17-12-11-13-18-30/h11-13,16-24,27,36H,9-10,14-15,25-26,28-29H2,1-8H3,(H,43,45)(H,46,47)/t36-/m0/s1 |
| InChIKey | UZPUBYOAPSRQIJ-BHVANESWSA-N |
| XLogP | 9.74 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.00 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|