C36H47ClN2O3Si — CID 68616953
5-[(1R)-2-[benzyl-[(1S)-1-chloropentyl]amino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-phenylmethoxy-1H-quinolin-2-one (PubChem CID 68616953) has the molecular formula C36H47ClN2O3Si and a molecular weight of 619.32 g/mol. Its IUPAC name is 5-[(1R)-2-[benzyl-[(1S)-1-chloropentyl]amino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-phenylmethoxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-[benzyl-[(1S)-1-chloropentyl]amino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 68616953 |
| Molecular Formula | C36H47ClN2O3Si |
| Molecular Weight | 619.32 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | 5-[(1R)-2-[benzyl-[(1S)-1-chloropentyl]amino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
| SMILES | CCCC[C@H](Cl)N(Cc1ccccc1)C[C@H](O[Si](C)(C)C(C)(C)C)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C36H47ClN2O3Si/c1-7-8-19-33(37)39(24-27-15-11-9-12-16-27)25-32(42-43(5,6)36(2,3)4)29-20-22-31(35-30(29)21-23-34(40)38-35)41-26-28-17-13-10-14-18-28/h9-18,20-23,32-33H,7-8,19,24-26H2,1-6H3,(H,38,40)/t32-,33+/m0/s1 |
| InChIKey | ZBKUQFNYXJNZDM-JHOUSYSJSA-N |
| XLogP | 9.43 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.32 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|