C39H47N3O3Si — CID 150786194
5-[(1R)-2-[[2-[2-(4-aminophenyl)ethyl]phenyl]methylamino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-phenylmethoxy-1H-quinolin-2-one (PubChem CID 150786194) has the molecular formula C39H47N3O3Si and a molecular weight of 633.91 g/mol. Its IUPAC name is 5-[(1R)-2-[[2-[2-(4-aminophenyl)ethyl]phenyl]methylamino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-phenylmethoxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-[[2-[2-(4-aminophenyl)ethyl]phenyl]methylamino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 150786194 |
| Molecular Formula | C39H47N3O3Si |
| Molecular Weight | 633.91 g/mol |
| Exact Mass | 633.34 |
| IUPAC Name | 5-[(1R)-2-[[2-[2-(4-aminophenyl)ethyl]phenyl]methylamino]-1-[tert-butyl(dimethyl)silyl]oxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CNCc1ccccc1CCc1ccc(N)cc1)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C39H47N3O3Si/c1-39(2,3)46(4,5)45-36(26-41-25-31-14-10-9-13-30(31)18-15-28-16-19-32(40)20-17-28)33-21-23-35(38-34(33)22-24-37(43)42-38)44-27-29-11-7-6-8-12-29/h6-14,16-17,19-24,36,41H,15,18,25-27,40H2,1-5H3,(H,42,43)/t36-/m0/s1 |
| InChIKey | KCXBKRRLJITYFG-BHVANESWSA-N |
| XLogP | 8.33 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.91 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|