C46H59N3O5Si — CID 69233936
benzyl N-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]-N-[6-(2-phenylethylamino)hexyl]carbamate (PubChem CID 69233936) has the molecular formula C46H59N3O5Si and a molecular weight of 762.08 g/mol. Its IUPAC name is benzyl N-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]-N-[6-(2-phenylethylamino)hexyl]carbamate.
| Compound Name | benzyl N-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]-N-[6-(2-phenylethylamino)hexyl]carbamate |
|---|---|
| PubChem CID | 69233936 |
| Molecular Formula | C46H59N3O5Si |
| Molecular Weight | 762.08 g/mol |
| Exact Mass | 761.42 |
| IUPAC Name | benzyl N-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]-N-[6-(2-phenylethylamino)hexyl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CN(CCCCCCNCCc1ccccc1)C(=O)OCc1ccccc1)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C46H59N3O5Si/c1-46(2,3)55(4,5)54-42(39-25-27-41(44-40(39)26-28-43(50)48-44)52-34-37-21-13-9-14-22-37)33-49(45(51)53-35-38-23-15-10-16-24-38)32-18-7-6-17-30-47-31-29-36-19-11-8-12-20-36/h8-16,19-28,42,47H,6-7,17-18,29-35H2,1-5H3,(H,48,50)/t42-/m0/s1 |
| InChIKey | KWVFGNXHYFBIOY-WBCKFURZSA-N |
| XLogP | 10.20 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.08 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|