C45H56N4O6Si — CID 66770159
[5-[3-[2-[benzyl-[2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]-5-oxopentyl]carbamic acid (PubChem CID 66770159) has the molecular formula C45H56N4O6Si and a molecular weight of 777.05 g/mol. Its IUPAC name is [5-[3-[2-[benzyl-[2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]-5-oxopentyl]carbamic acid.
| Compound Name | [5-[3-[2-[benzyl-[2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]-5-oxopentyl]carbamic acid |
|---|---|
| PubChem CID | 66770159 |
| Molecular Formula | C45H56N4O6Si |
| Molecular Weight | 777.05 g/mol |
| Exact Mass | 776.40 |
| IUPAC Name | [5-[3-[2-[benzyl-[2-[tert-butyl(dimethyl)silyl]oxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]-5-oxopentyl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CN(CCc1cccc(NC(=O)CCCCNC(=O)O)c1)Cc1ccccc1)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C45H56N4O6Si/c1-45(2,3)56(4,5)55-40(37-22-24-39(43-38(37)23-25-42(51)48-43)54-32-35-17-10-7-11-18-35)31-49(30-34-15-8-6-9-16-34)28-26-33-19-14-20-36(29-33)47-41(50)21-12-13-27-46-44(52)53/h6-11,14-20,22-25,29,40,46H,12-13,21,26-28,30-32H2,1-5H3,(H,47,50)(H,48,51)(H,52,53) |
| InChIKey | MQNVZACAGIGXOB-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.05 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|