C34H34N4O4 — CID 91610204
1-benzyl-3-[3-[2-[[2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]urea (PubChem CID 91610204) has the molecular formula C34H34N4O4 and a molecular weight of 562.67 g/mol. Its IUPAC name is 1-benzyl-3-[3-[2-[[2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]urea.
| Compound Name | 1-benzyl-3-[3-[2-[[2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]urea |
|---|---|
| PubChem CID | 91610204 |
| Molecular Formula | C34H34N4O4 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | 1-benzyl-3-[3-[2-[[2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenyl]urea |
| SMILES | O=C(NCc1ccccc1)Nc1cccc(CCNCC(O)c2ccc(OCc3ccccc3)c3[nH]c(=O)ccc23)c1 |
| InChI | InChI=1S/C34H34N4O4/c39-30(28-14-16-31(33-29(28)15-17-32(40)38-33)42-23-26-10-5-2-6-11-26)22-35-19-18-24-12-7-13-27(20-24)37-34(41)36-21-25-8-3-1-4-9-25/h1-17,20,30,35,39H,18-19,21-23H2,(H,38,40)(H2,36,37,41) |
| InChIKey | WGYITVZRTRAXJZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|